2,4-Pentadien-2-ol,5-(phenylamino)-1-(phenylimino)-, hydrochloride (1:1) structure
|
Common Name | 2,4-Pentadien-2-ol,5-(phenylamino)-1-(phenylimino)-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 17315-76-3 | Molecular Weight | 300.78300 | |
| Density | 1.03g/cm3 | Boiling Point | 434.9ºC at 760mmHg | |
| Molecular Formula | C17H17ClN2O | Melting Point | 172-188ºC | |
| MSDS | N/A | Flash Point | 216.8ºC | |
| Name | (2Z,4E)-5-anilino-1-phenyliminopenta-2,4-dien-2-ol,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 434.9ºC at 760mmHg |
| Melting Point | 172-188ºC |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.78300 |
| Flash Point | 216.8ºC |
| Exact Mass | 300.10300 |
| PSA | 44.95000 |
| LogP | 4.51050 |
| Vapour Pressure | 2.47E-08mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | ZXBHEZGIQUDBPG-UHFFFAOYSA-N |
| SMILES | Cl.OC(C=Nc1ccccc1)=CC=CNc1ccccc1 |
| Risk Phrases | 48/20/21/22 |
|---|---|
| Safety Phrases | 22-36/37/39 |
| HS Code | 2925290090 |
|
~%
2,4-Pentadien-2... CAS#:17315-76-3 |
| Literature: Williams; Wilson Journal of the Chemical Society, 1942 , p. 506 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 5-anilino-2-hydroxy-penta-2,4-dienal-phenylimine,hydrochloride |
| 5-Anilino-2-hydroxy-penta-2,4-dienal-phenylimin,Hydrochlorid |