3beta,4beta-Dihydroxycholest-5-ene structure
|
Common Name | 3beta,4beta-Dihydroxycholest-5-ene | ||
|---|---|---|---|---|
| CAS Number | 17320-10-4 | Molecular Weight | 402.653 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 500.2±30.0 °C at 760 mmHg | |
| Molecular Formula | C27H46O2 | Melting Point | 175-176 °C | |
| MSDS | N/A | Flash Point | 206.7±19.2 °C | |
Use of 3beta,4beta-Dihydroxycholest-5-ene4β-hydroxy Cholesterol is a major oxysterol cholesterol metabolite and a precursor in the synthesis of bile acids that is found in human circulation[1]. |
| Name | 4β-hydroxycholesterol |
|---|---|
| Synonym | More Synonyms |
| Description | 4β-hydroxy Cholesterol is a major oxysterol cholesterol metabolite and a precursor in the synthesis of bile acids that is found in human circulation[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 500.2±30.0 °C at 760 mmHg |
| Melting Point | 175-176 °C |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.653 |
| Flash Point | 206.7±19.2 °C |
| Exact Mass | 402.349792 |
| PSA | 40.46000 |
| LogP | 8.80 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | CZDKQKOAHAICSF-RJWVQXRLSA-N |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4C(O)C(O)CCC4(C)C3CCC12C |
| Storage condition | 2-8°C |
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| 4beta-hydroxycholesterol |
| Cholest-5-ene-3beta,4beta-diol |
| Cholest-5-ene-3β,4β-diol |
| 4-Hydroxy Cholesterol |
| cholest-5-ene-3,4-diol |
| (3β,4β)-Cholest-5-ene-3,4-diol |
| 4β-hydroxy-cholesterol |
| 4β-Hydroxycholesterol |
| Cholest-5-ene-3,4-diol, (3β,4β)- |
| cholest-5-en-3β,4β-diol |
| 4-β-HYDROXYCHOLESTEROL |