N-Benzyloxycarbonylserylleucinamide structure
|
Common Name | N-Benzyloxycarbonylserylleucinamide | ||
|---|---|---|---|---|
| CAS Number | 17331-87-2 | Molecular Weight | 351.39800 | |
| Density | 1.218g/cm3 | Boiling Point | 656.9ºC at 760mmHg | |
| Molecular Formula | C17H25N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 351.1ºC | |
Use of N-BenzyloxycarbonylserylleucinamideN-Benzyloxycarbonylserylleucinamide is a bioactive chemical. |
| Name | benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 656.9ºC at 760mmHg |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.39800 |
| Flash Point | 351.1ºC |
| Exact Mass | 351.17900 |
| PSA | 130.75000 |
| LogP | 1.77200 |
| Vapour Pressure | 3.77E-18mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | OPXHXTSKUSVXIO-KBPBESRZSA-N |
| SMILES | CC(C)CC(NC(=O)C(CO)NC(=O)OCc1ccccc1)C(N)=O |
| N-Carbobenzoxy-seryl-leucinamide |
| Z-L-Ser-L-Leu-NH2 |
| N-Benzyloxycarbonylserylleucinamide |
| Cbz-ser-leu-NH2 |