N-Benzyloxycarbonylserylleucinamide
N-Benzyloxycarbonylserylleucinamide structure
|
Common Name | N-Benzyloxycarbonylserylleucinamide | ||
|---|---|---|---|---|
| CAS Number | 17331-87-2 | Molecular Weight | 351.39800 | |
| Density | 1.218g/cm3 | Boiling Point | 656.9ºC at 760mmHg | |
| Molecular Formula | C17H25N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 351.1ºC | |
Use of N-BenzyloxycarbonylserylleucinamideN-Benzyloxycarbonylserylleucinamide is a bioactive chemical. |
Summary: N-Benzyloxycarbonylserylleucinamide, a bioactive chemical, has the Chinese name of 苯基N-[(2S)-1-[[(2S)-1-氨基-4-甲基-1-氧戊烷-2-基]氨基]-3-羟基-1-氧丙基]碳酸酯. Its CAS number is 17331-87-2, with a molecular formula of C17H25N3O5 and a molecular weight of 351.39800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 656.9ºC at 760mmHg |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.39800 |
| Flash Point | 351.1ºC |
| Exact Mass | 351.17900 |
| PSA | 130.75000 |
| LogP | 1.77200 |
| Vapour Pressure | 3.77E-18mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | OPXHXTSKUSVXIO-KBPBESRZSA-N |
| SMILES | CC(C)CC(NC(=O)C(CO)NC(=O)OCc1ccccc1)C(N)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
![methyl 2-[(3-hydroxy-2-phenylmethoxycarbonylamino-propanoyl)amino]-4-methyl-pentanoate Structure](https://image.chemsrc.com/caspic/177/17331-94-1.png)
CAS#:17331-94-1
CAS#:687-51-4
CAS#:1676-81-9
CAS#:1145-80-8
CAS#:10466-61-2
CAS#:6169-33-1
CAS#:21209-51-8
CAS#:2666-93-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-Carbobenzoxy-seryl-leucinamide |
| Z-L-Ser-L-Leu-NH2 |
| N-Benzyloxycarbonylserylleucinamide |
| Cbz-ser-leu-NH2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate? |
| A: CAS number of benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate is 17331-87-2. |
| Q: What is the English name of benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate? |
| A: The English name of benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate is benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate. |
| Q: What is the boiling point of benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate? |
| A: Boiling point of benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate is 656.9ºC at 760mmHg. |
| Q: What is the LogP of benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate? |
| A: LogP of benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate is 1.77200. |
| Q: What are the upstream materials of benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate? |
| A: Related upstream materials(CAS) of benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate: 17331-94-1;687-51-4;1676-81-9;1145-80-8;10466-61-2;6169-33-1;21209-51-8;2666-93-5. |
| Q: What is the molecular weight of benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate? |
| A: Molecular weight of benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate is 351.39800. |
| Q: What is the polar surface area (PSA) of benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate? |
| A: Polar surface area (PSA) of benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate is 130.75000. |
| Q: What English synonyms does benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate have? |
| A: English synonyms of benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate: N-Carbobenzoxy-seryl-leucinamide, Z-L-Ser-L-Leu-NH2, N-Benzyloxycarbonylserylleucinamide, Cbz-ser-leu-NH2. |
| Q: What is the SMILES notation of benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate? |
| A: SMILES notation of benzyl N-[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate is CC(C)CC(NC(=O)C(CO)NC(=O)OCc1ccccc1)C(N)=O. |
| Q: What is the Chinese name of 17331-87-2? |
| A: Chinese name of 17331-87-2 is 17331-87-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |