Lamivudine salicylate structure
|
Common Name | Lamivudine salicylate | ||
|---|---|---|---|---|
| CAS Number | 173522-96-8 | Molecular Weight | 367.377 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17N3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Lamivudine salicylateLamivudine (BCH-189) salicylate is an orally active nucleoside reverse transcriptase inhibitor (NRTI). Lamivudine salicylate can inhibit HIV reverse transcriptase 1/2 and also the reverse transcriptase of hepatitis B virus. Lamivudine salicylate can penetrate the CNS[1][2]. |
| Name | [(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl 2-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Description | Lamivudine (BCH-189) salicylate is an orally active nucleoside reverse transcriptase inhibitor (NRTI). Lamivudine salicylate can inhibit HIV reverse transcriptase 1/2 and also the reverse transcriptase of hepatitis B virus. Lamivudine salicylate can penetrate the CNS[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H17N3O6S |
|---|---|
| Molecular Weight | 367.377 |
| Exact Mass | 367.083801 |
| PSA | 173.20000 |
| LogP | 1.07750 |
| InChIKey | MUAWHSKZVSAWMH-QWHCGFSZSA-N |
| SMILES | Nc1ccn(C2CSC(COC(=O)c3ccccc3O)O2)c(=O)n1 |
|
~%
Lamivudine sali... CAS#:173522-96-8 |
| Literature: WO2009/69012 A1, ; Page/Page column 22-23 ; |
|
~%
Lamivudine sali... CAS#:173522-96-8 |
| Literature: WO2009/69011 A1, ; Page/Page column 17-18 ; |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| 2-Hydroxybenzoic acid - 4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2(1H)-pyrimidinone (1:1) |
| Benzoic acid, 2-hydroxy-, compd. with 4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2(1H)-pyrimidinone (1:1) |
| lamivudine salicylate |