2-OXO-2-(4-(TRIFLUOROMETHYL)PHENYL)ACETALDEHYDE structure
|
Common Name | 2-OXO-2-(4-(TRIFLUOROMETHYL)PHENYL)ACETALDEHYDE | ||
|---|---|---|---|---|
| CAS Number | 1736-56-7 | Molecular Weight | 220.14500 | |
| Density | N/A | Boiling Point | 223.3ºC at 760mmHg | |
| Molecular Formula | C9H7F3O3 | Melting Point | 83-85ºC | |
| MSDS | N/A | Flash Point | 84.1ºC | |
| Name | 4-(trifluoromethyl)phenylglyoxal hydrate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 223.3ºC at 760mmHg |
|---|---|
| Melting Point | 83-85ºC |
| Molecular Formula | C9H7F3O3 |
| Molecular Weight | 220.14500 |
| Flash Point | 84.1ºC |
| Exact Mass | 220.03500 |
| PSA | 57.53000 |
| LogP | 1.19880 |
| Vapour Pressure | 0.0971mmHg at 25°C |
| InChIKey | BGOMXTCPIUNFKR-UHFFFAOYSA-N |
| SMILES | O=CC(=O)c1ccc(C(F)(F)F)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2914700090 |
|
~97%
2-OXO-2-(4-(TRI... CAS#:1736-56-7 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 18, # 7 p. 2455 - 2458 |
|
~%
2-OXO-2-(4-(TRI... CAS#:1736-56-7 |
| Literature: Journal of medicinal chemistry, , vol. 15, # 9 p. 989 - 994 |
|
~%
2-OXO-2-(4-(TRI... CAS#:1736-56-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 6, p. 787 - 791 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-[4-(trifluoromethyl)phenyl]-2-oxoethanal |
| 2-Oxo-2-(4-(trifluoroMethyl)phenyl)acetaldehyde |
| (4-trifluoromethylphenyl)(oxo)acetaldehyde |
| 1-Trifluormethyl-4-glyoxyloyl-benzol |
| 4'-(trifluoromethyl)phenylglyoxal |
| Oxo[4-(Trifluoromethyl)Phenyl]Acetaldehyde Hydrate |
| MFCD05664098 |
| 4-(Trifluoromethyl)phenylglyoxal hydrate |