4,6-diphenyl-2-pyrone structure
|
Common Name | 4,6-diphenyl-2-pyrone | ||
|---|---|---|---|---|
| CAS Number | 17372-52-0 | Molecular Weight | 248.27600 | |
| Density | 1.211g/cm3 | Boiling Point | 462.2ºC at 760 mmHg | |
| Molecular Formula | C17H12O2 | Melting Point | 135-138°C | |
| MSDS | N/A | Flash Point | 195.7ºC | |
| Name | 4,6-diphenylpyran-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 462.2ºC at 760 mmHg |
| Melting Point | 135-138°C |
| Molecular Formula | C17H12O2 |
| Molecular Weight | 248.27600 |
| Flash Point | 195.7ºC |
| Exact Mass | 248.08400 |
| PSA | 30.21000 |
| LogP | 3.97380 |
| Vapour Pressure | 1.01E-08mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | DDGIHXFDWLCKRZ-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccccc2)cc(-c2ccccc2)o1 |
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S22-S24/25 |
| HS Code | 2932999099 |
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6-diphenyl-2-pyranone |
| 4,6-diphenyl-pyran-2-one |
| 4,6-DIPHENYL-2H-PYRAN-2-ONE |
| 4,6-Diphenyl-2-pyrone |
| MFCD00031018 |