CDD3505 structure
|
Common Name | CDD3505 | ||
|---|---|---|---|---|
| CAS Number | 173865-33-3 | Molecular Weight | 355.389 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 515.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C22H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.7±28.7 °C | |
Use of CDD3505CDD3505 is used for elevating high density lipoprotein cholesterol (HDL) by inducing hepatic cytochrome P450IIIA (CYP3A) activity. |
| Name | CDD3505 |
|---|---|
| Synonym | More Synonyms |
| Description | CDD3505 is used for elevating high density lipoprotein cholesterol (HDL) by inducing hepatic cytochrome P450IIIA (CYP3A) activity. |
|---|---|
| Related Catalog | |
| In Vitro | CDD3505 specifically induces hepatic cytochrome P450IIIA produces significant increases in HDL cholesterol[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 515.7±45.0 °C at 760 mmHg |
| Molecular Formula | C22H17N3O2 |
| Molecular Weight | 355.389 |
| Flash Point | 265.7±28.7 °C |
| Exact Mass | 355.132080 |
| LogP | 5.02 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | MUQGVERJAKANJN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
| Storage condition | 2-8℃ |
| 4-Nitro-1-trityl-1H-imidazole |
| 1H-Imidazole, 4-nitro-1-(triphenylmethyl)- |
| 1-trityl-4-nitroimidazole |