2-bromo-2,2-diphenylacetyl chloride structure
|
Common Name | 2-bromo-2,2-diphenylacetyl chloride | ||
|---|---|---|---|---|
| CAS Number | 17397-37-4 | Molecular Weight | 354.03700 | |
| Density | 1.688g/cm3 | Boiling Point | 360.6ºC at 760 mmHg | |
| Molecular Formula | C14H10Br2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 88.1ºC | |
| Name | 2-bromo-2,2-diphenylacetyl bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.688g/cm3 |
|---|---|
| Boiling Point | 360.6ºC at 760 mmHg |
| Molecular Formula | C14H10Br2O |
| Molecular Weight | 354.03700 |
| Flash Point | 88.1ºC |
| Exact Mass | 351.91000 |
| PSA | 17.07000 |
| LogP | 4.24660 |
| Vapour Pressure | 2.19E-05mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | ZFQFBVWNRNLAFC-UHFFFAOYSA-N |
| SMILES | O=C(Br)C(Br)(c1ccccc1)c1ccccc1 |
| RIDADR | UN 1759 |
|---|---|
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2916399090 |
|
~%
2-bromo-2,2-dip... CAS#:17397-37-4 |
| Literature: Staudinger Justus Liebigs Annalen der Chemie, 1907 , vol. 356, p. 122 |
|
~%
2-bromo-2,2-dip... CAS#:17397-37-4 |
| Literature: Klinger; Nickell Justus Liebigs Annalen der Chemie, 1912 , vol. 390, p. 366 |
|
~%
2-bromo-2,2-dip... CAS#:17397-37-4 |
| Literature: Klinger Justus Liebigs Annalen der Chemie, 1912 , vol. 389, p. 250 Justus Liebigs Annalen der Chemie, 1912 , vol. 390, p. 375 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Bromo-2,2-diphenylacetyl chloride |
| EINECS 241-423-2 |
| 2-bromo-2,2-diphenylacetylbromide |
| Brom-diphenyl-acetylbromid |
| bromo-diphenyl-acetyl bromide |