N-Boc-cis-4-Fmoc-Amino-L-proline structure
|
Common Name | N-Boc-cis-4-Fmoc-Amino-L-proline | ||
|---|---|---|---|---|
| CAS Number | 174148-03-9 | Molecular Weight | 452.50000 | |
| Density | 1.33g/cm3 | Boiling Point | 650.2ºC at 760mmHg | |
| Molecular Formula | C25H28N2O6 | Melting Point | 150-154ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 347ºC | |
| Name | (4S)-4-N-Fmoc-amino-1-Boc-L-proline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 650.2ºC at 760mmHg |
| Melting Point | 150-154ºC(lit.) |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.50000 |
| Flash Point | 347ºC |
| Exact Mass | 452.19500 |
| PSA | 105.17000 |
| LogP | 4.31650 |
| Index of Refraction | 1.627 |
| InChIKey | UPXRTVAIJMUAQR-BTYIYWSLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(NC(=O)OCC2c3ccccc3-c3ccccc32)CC1C(=O)O |
| Storage condition | Store at 0-5°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | T+ |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29242990 |
|
~97%
N-Boc-cis-4-Fmo... CAS#:174148-03-9 |
| Literature: WO2006/20276 A2, ; Page/Page column 352-353 ; |
|
~87%
N-Boc-cis-4-Fmo... CAS#:174148-03-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 51, # 6 p. 1771 - 1782 |
| N-Boc-cis-4-N-Fmoc-amino-L-proline |
| N-Boc-cis-4-Fmoc-Amino-L-proline |
| MFCD00673782 |