N-BOC-cis-4-fluoro-L-proline structure
|
Common Name | N-BOC-cis-4-fluoro-L-proline | ||
|---|---|---|---|---|
| CAS Number | 203866-13-1 | Molecular Weight | 233.24 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 346.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H16FNO4 | Melting Point | 157-161.ºC | |
| MSDS | Chinese USA | Flash Point | 163.0±27.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of N-BOC-cis-4-fluoro-L-prolineN-tert-Boc-cis-4-fluoro-L-proline is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | (2S,4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | N-tert-Boc-cis-4-fluoro-L-proline is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 346.0±42.0 °C at 760 mmHg |
| Melting Point | 157-161.ºC |
| Molecular Formula | C10H16FNO4 |
| Molecular Weight | 233.24 |
| Flash Point | 163.0±27.9 °C |
| Exact Mass | 233.106339 |
| PSA | 66.84000 |
| LogP | 0.48 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.488 |
| InChIKey | YGWZXQOYEBWUTH-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(F)CC1C(=O)O |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
|
~98%
N-BOC-cis-4-flu... CAS#:203866-13-1 |
| Literature: SUNSHINE LAKE PHARMA CO.,LTD.; ZHANG, Jiancun; ZHANG, Yingjun; XIE, Hongming; REN, Qingyun; HU, Bailin; FU, Changping; WU, Xiwei; LI, Shifeng; WANG, Chenglin; ZHANG, Zhikeng Patent: WO2014/82379 A1, 2014 ; Location in patent: Page/Page column 144; 145 ; |
|
~%
N-BOC-cis-4-flu... CAS#:203866-13-1 |
| Literature: Journal of the American Chemical Society, , vol. 125, # 31 p. 9262 - 9263 |
|
~%
N-BOC-cis-4-flu... CAS#:203866-13-1 |
| Literature: Journal of the American Chemical Society, , vol. 125, # 31 p. 9262 - 9263 |
|
~%
N-BOC-cis-4-flu... CAS#:203866-13-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 15 p. 4167 - 4172 |
|
~%
N-BOC-cis-4-flu... CAS#:203866-13-1 |
| Literature: Tetrahedron Letters, , vol. 39, # 10 p. 1169 - 1172 |
|
~%
N-BOC-cis-4-flu... CAS#:203866-13-1 |
| Literature: Tetrahedron Letters, , vol. 39, # 10 p. 1169 - 1172 |
|
~0%
Detail
|
| Literature: WO2006/80401 A1, ; Page/Page column 38-40 ; |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Boc-cis-4F-Pro |
| (2S,4S)-1-(tert-Butoxycarbonyl)-4-fluoro-2-pyrrolidinecarboxylic Acid |
| 1,2-Pyrrolidinedicarboxylic acid, 4-fluoro-, 1-(1,1-dimethylethyl) ester, (2S,4S)- |
| BOC-FLP-OH |
| (2S,4S)-N-Boc-4-fluoroproline |
| BOC-CIS-PRO(4-F)-OH |
| (2S,4S)-1-(tert-Butoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid |
| N-Boc-cis-4-fluoro-L-proline |
| BOC-CIS-4-FLUORO-PRO-OH |
| (4S)-1-(tert-Butoxycarbonyl)-4-fluor-L-prolin |
| (2S,4S)-1-Boc-4-fluoro-2-pyrrolidinecarboxylic Acid |
| (4S)-1-(tert-Butoxycarbonyl)-4-fluoro-L-proline |
| (4S)-4-Fluoro-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-proline |
| 1-(tert-butoxycarbonyl)-(4S)-fluoropyrrolidine-(2S)-carboxylic acid |
| N-t-BOC-cis-4-Fluoro-L-proline |
| BOC-CIS-4-FLUORO-L-PROLINE |
| N-(tert-Butoxycarbonyl)-cis-4-fluoro-L-proline |
| MFCD04973957 |
| N-tert-butoxycarbonyl-cis-4-fluoro-L-proline |
| 1-(tert-butoxycarbonyl)-(4S)-fluoro-(2S)-pyrrolidinylcarboxylic |