2-Fluoro-5-nitrobenzonitrile structure
|
Common Name | 2-Fluoro-5-nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 17417-09-3 | Molecular Weight | 166.10900 | |
| Density | 1.41g/cm3 | Boiling Point | 94 °C / 0.5mmHg | |
| Molecular Formula | C7H3FN2O2 | Melting Point | 76-80 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 111.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Fluoro-5-nitrobenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 94 °C / 0.5mmHg |
| Melting Point | 76-80 °C(lit.) |
| Molecular Formula | C7H3FN2O2 |
| Molecular Weight | 166.10900 |
| Flash Point | 111.4ºC |
| Exact Mass | 166.01800 |
| PSA | 69.61000 |
| LogP | 2.12878 |
| Vapour Pressure | 0.0608mmHg at 25°C |
| Index of Refraction | 1.503 |
| InChIKey | YLACBMHBZVYOAP-UHFFFAOYSA-N |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36-S36/37/39 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2926909090 |
|
~84%
2-Fluoro-5-nitr... CAS#:17417-09-3 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 28, # 3 p. 685 - 695 |
|
~96%
2-Fluoro-5-nitr... CAS#:17417-09-3 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 34, # 4 p. 1163 - 1172 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00042299 |
| 2-Fluoro-5-Nitrobenzonitrile |
| 3-Cyano-4-fluoro-1-nitrobenzene |
| 2-fluoro-5-nitro-benzonitrile |
| 2-Fluoro-5-nitrobenzenenitrile |
| 3-Cyano-4-fluoronitrobenzene |
| 2-fluoro-5-nitro-bezonitrile |