(S)-tert-butyl 2-(phenoxymethyl)pyrrolidine-1-carboxylate structure
|
Common Name | (S)-tert-butyl 2-(phenoxymethyl)pyrrolidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 174213-51-5 | Molecular Weight | 277.35900 | |
| Density | 1.082g/cm3 | Boiling Point | 373.73ºC at 760 mmHg | |
| Molecular Formula | C16H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.826ºC | |
| Name | tert-butyl (2S)-2-(phenoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.082g/cm3 |
|---|---|
| Boiling Point | 373.73ºC at 760 mmHg |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.35900 |
| Flash Point | 179.826ºC |
| Exact Mass | 277.16800 |
| PSA | 38.77000 |
| LogP | 3.40280 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | HNDZHKHZJFMDRO-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC1COc1ccccc1 |
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| i01-9425 |