SDZ285428 structure
|
Common Name | SDZ285428 | ||
|---|---|---|---|---|
| CAS Number | 174262-13-6 | Molecular Weight | 401.888 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 651.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H20ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 347.7±31.5 °C | |
Use of SDZ285428SDZ285428 is a CYP51 inhibitor. SDZ285428 inhibits Trypanosoma cruzi (TC) CYP51 with I/E2 <1 (5 min) and I/E2=9 (1 h). SDZ285428 inhibits Trypanosoma brucei (TB) CYP51 with I/E2 <1 (5 min) and I/E2=35 (1 h)[1]. |
| Name | 4'-Chloro-N-[2-(1H-imidazol-1-yl)-2-phenylethyl]-4-biphenylcarboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | SDZ285428 is a CYP51 inhibitor. SDZ285428 inhibits Trypanosoma cruzi (TC) CYP51 with I/E2 <1 (5 min) and I/E2=9 (1 h). SDZ285428 inhibits Trypanosoma brucei (TB) CYP51 with I/E2 <1 (5 min) and I/E2=35 (1 h)[1]. |
|---|---|
| Related Catalog | |
| Target |
CYP51 |
| In Vivo | Specific inhibition of protozoan CYP51 can potentially provide treatment for human trypanosomiases[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 651.2±55.0 °C at 760 mmHg |
| Molecular Formula | C24H20ClN3O |
| Molecular Weight | 401.888 |
| Flash Point | 347.7±31.5 °C |
| Exact Mass | 401.129486 |
| LogP | 4.54 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | FHHNSSGZEIVGMS-UHFFFAOYSA-N |
| SMILES | O=C(NCC(c1ccccc1)n1ccnc1)c1ccc(-c2ccc(Cl)cc2)cc1 |
| Storage condition | -20℃ |
| 4'-chloro-N-[2-(1H-imidazol-1-yl)-2-phenylethyl]biphenyl-4-carboxamide |
| 4'-Chloro-N-[2-(1H-imidazol-1-yl)-2-phenylethyl]-4-biphenylcarboxamide |
| [1,1'-Biphenyl]-4-carboxamide, 4'-chloro-N-[2-(1H-imidazol-1-yl)-2-phenylethyl]- |