2,2,2-trichloro-N-(4-fluorophenyl)acetamide structure
|
Common Name | 2,2,2-trichloro-N-(4-fluorophenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 1744-18-9 | Molecular Weight | 256.48900 | |
| Density | 1.593g/cm3 | Boiling Point | 326ºC at 760 mmHg | |
| Molecular Formula | C8H5Cl3FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151ºC | |
| Name | 2,2,2-trichloro-N-(4-fluorophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.593g/cm3 |
|---|---|
| Boiling Point | 326ºC at 760 mmHg |
| Molecular Formula | C8H5Cl3FNO |
| Molecular Weight | 256.48900 |
| Flash Point | 151ºC |
| Exact Mass | 254.94200 |
| PSA | 29.10000 |
| LogP | 3.20740 |
| Vapour Pressure | 0.000222mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | LITIWTUEINGYRF-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(F)cc1)C(Cl)(Cl)Cl |
| HS Code | 2924299090 |
|---|
|
~69%
2,2,2-trichloro... CAS#:1744-18-9 |
| Literature: Chakraborty, Kajal; Devakumar Journal of Agricultural and Food Chemistry, 2005 , vol. 53, # 20 p. 7899 - 7907 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Trichloracetyl-4-fluor-anilin |
| 4'-fluoro-trichloroacetanilide |