2,2,2-trichloro-N-(4-sulfamoylphenyl)acetamide structure
|
Common Name | 2,2,2-trichloro-N-(4-sulfamoylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 22795-59-1 | Molecular Weight | 317.57700 | |
| Density | 1.71g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H7Cl3N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,2-trichloro-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.71g/cm3 |
|---|---|
| Molecular Formula | C8H7Cl3N2O3S |
| Molecular Weight | 317.57700 |
| Exact Mass | 315.92400 |
| PSA | 97.64000 |
| LogP | 3.49680 |
| Index of Refraction | 1.637 |
| InChIKey | UVSDXEXYSKIAKH-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C(Cl)(Cl)Cl)cc1 |
|
~%
2,2,2-trichloro... CAS#:22795-59-1 |
| Literature: Journal of the American Chemical Society, , vol. 63, p. 2243 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-trichloroacetyl-sulfanilic acid amide |
| Acetanilide,2,2,2-trichloro-4'-sulfamoyl |
| N-Trichloracetyl-sulfanilsaeure-amid |
| 2,2,2-Trichloro-4'-sulfamoylacetanilide |