1-(4-methoxyphenyl)imidazoline-2-thione structure
|
Common Name | 1-(4-methoxyphenyl)imidazoline-2-thione | ||
|---|---|---|---|---|
| CAS Number | 17452-14-1 | Molecular Weight | 206.26400 | |
| Density | 1.32g/cm3 | Boiling Point | 336.6ºC at 760mmHg | |
| Molecular Formula | C10H10N2OS | Melting Point | 216-217°C | |
| MSDS | N/A | Flash Point | 157.4ºC | |
| Name | 1-(4-methoxyphenyl)imidazoline-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 336.6ºC at 760mmHg |
| Melting Point | 216-217°C |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.26400 |
| Flash Point | 157.4ºC |
| Exact Mass | 206.05100 |
| PSA | 62.04000 |
| LogP | 2.54350 |
| Vapour Pressure | 0.000111mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | LIEBCNQPMNARMP-UHFFFAOYSA-N |
| SMILES | COc1ccc(-n2cc[nH]c2=S)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Safety Phrases | S22-S24/25 |
| HS Code | 2933290090 |
|
~%
1-(4-methoxyphe... CAS#:17452-14-1 |
| Literature: European Journal of Inorganic Chemistry, , # 13 p. 2502 - 2511 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00041376 |
| 1-(4-Methoxyphenyl)-1H-imidazole-2(3H)-thione |
| 1-(4-Methoxyphenyl)imidazoline-2-thione |
| 3-(4-methoxyphenyl)-1H-imidazole-2-thione |