1-(4-Bromophenyl)imidazoline-2-thione structure
|
Common Name | 1-(4-Bromophenyl)imidazoline-2-thione | ||
|---|---|---|---|---|
| CAS Number | 17452-23-2 | Molecular Weight | 255.13400 | |
| Density | 1.74g/cm3 | Boiling Point | 342.3ºC at 760mmHg | |
| Molecular Formula | C9H7BrN2S | Melting Point | 244ºC | |
| MSDS | N/A | Flash Point | 160.8ºC | |
| Name | 1-(4-Bromophenyl)imidazoline-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.74g/cm3 |
|---|---|
| Boiling Point | 342.3ºC at 760mmHg |
| Melting Point | 244ºC |
| Molecular Formula | C9H7BrN2S |
| Molecular Weight | 255.13400 |
| Flash Point | 160.8ºC |
| Exact Mass | 253.95100 |
| PSA | 52.81000 |
| LogP | 3.29740 |
| Vapour Pressure | 7.58E-05mmHg at 25°C |
| Index of Refraction | 1.769 |
| InChIKey | ZKPXIPSWVWPFDF-UHFFFAOYSA-N |
| SMILES | S=c1[nH]ccn1-c1ccc(Br)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933290090 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(4-bromophenyl)-1H-imidazole-2-thione |
| MFCD00060482 |