1-Benzyl 3-methyl 1,3-piperidinedicarboxylate structure
|
Common Name | 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 174543-74-9 | Molecular Weight | 277.316 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 440.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.1±28.7 °C | |
| Name | Piperidine-1,3-Dicarboxylic Acid 1-Benzyl Ester 3-Methyl Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 440.3±45.0 °C at 760 mmHg |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.316 |
| Flash Point | 220.1±28.7 °C |
| Exact Mass | 277.131409 |
| PSA | 55.84000 |
| LogP | 2.24 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | BMBZPWAQRLLZBC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCCN(C(=O)OCc2ccccc2)C1 |
| HS Code | 2933399090 |
|---|
|
~%
1-Benzyl 3-meth... CAS#:174543-74-9 |
| Literature: Tetrahedron Letters, , vol. 37, # 8 p. 1297 - 1300 |
|
~%
1-Benzyl 3-meth... CAS#:174543-74-9 |
| Literature: Tetrahedron Letters, , vol. 37, # 8 p. 1297 - 1300 |
|
~%
1-Benzyl 3-meth... CAS#:174543-74-9 |
| Literature: Tetrahedron Letters, , vol. 37, # 8 p. 1297 - 1300 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-O-benzyl 3-O-methyl piperidine-1,3-dicarboxylate |
| 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate |
| 1-[(Benzyloxy)carbonyl]-3-methyl-3-piperidinecarboxylic acid |
| Methyl-N-CBZ-piperidine-3-carboxylate |
| 1,3-Piperidinedicarboxylic acid, 3-methyl 1-(phenylmethyl) ester |
| Methyl N-Cbz-piperidine-3-carboxylate |
| 1-[(Benzyloxy)carbonyl]-3-methylpiperidine-3-carboxylic acid |
| 1,3-Piperidinedicarboxylic acid, 3-methyl-, 1-(phenylmethyl) ester |