SDZ 220-040 structure
|
Common Name | SDZ 220-040 | ||
|---|---|---|---|---|
| CAS Number | 174575-40-7 | Molecular Weight | 420.18 | |
| Density | 1.612g/cm3 | Boiling Point | 653.5ºC at 760 mmHg | |
| Molecular Formula | C16H16Cl2NO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 349ºC | |
Use of SDZ 220-040SDZ 220-040 is a competitive the mammalian NMDA receptor antagonist[1]. |
| Name | SDZ 220-040,(S)-α-Amino-2',4'-dichloro-4-hydroxy-5-(phosphonomethyl)-[1,1'-biphenyl]-3-propanoicacid |
|---|---|
| Synonym | More Synonyms |
| Description | SDZ 220-040 is a competitive the mammalian NMDA receptor antagonist[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.612g/cm3 |
|---|---|
| Boiling Point | 653.5ºC at 760 mmHg |
| Molecular Formula | C16H16Cl2NO6P |
| Molecular Weight | 420.18 |
| Flash Point | 349ºC |
| Exact Mass | 419.00900 |
| PSA | 150.89000 |
| LogP | 3.69840 |
| Vapour Pressure | 5.75E-18mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | NYZFUZCCDOSQBG-AWEZNQCLSA-N |
| SMILES | NC(Cc1cc(-c2ccc(Cl)cc2Cl)cc(CP(=O)(O)O)c1O)C(=O)O |
| SDZ 220-040 |
| Calcein AM |