Benzenamine,4-methoxy-N-[(4-methoxyphenyl)methylene] structure
|
Common Name | Benzenamine,4-methoxy-N-[(4-methoxyphenyl)methylene] | ||
|---|---|---|---|---|
| CAS Number | 1749-08-2 | Molecular Weight | 241.28500 | |
| Density | 1.03g/cm3 | Boiling Point | 389.5ºC at 760 mmHg | |
| Molecular Formula | C15H15NO2 | Melting Point | 146-150ºC(lit.) | |
| MSDS | Chinese | Flash Point | 153.2ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | N,1-bis(4-methoxyphenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 389.5ºC at 760 mmHg |
| Melting Point | 146-150ºC(lit.) |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28500 |
| Flash Point | 153.2ºC |
| Exact Mass | 241.11000 |
| PSA | 30.82000 |
| LogP | 3.45440 |
| Vapour Pressure | 6.38E-06mmHg at 25°C |
| Index of Refraction | 1.53 |
| InChIKey | ZDOHZYPZEUJYKN-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=Nc2ccc(OC)cc2)cc1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H317-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2925290090 |
| Precursor 9 | |
|---|---|
| DownStream 8 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| n-(4-methoxybenzylidene)-p-anisidine |
| MFCD00025800 |