Parishin B structure
|
Common Name | Parishin B | ||
|---|---|---|---|---|
| CAS Number | 174972-79-3 | Molecular Weight | 728.649 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 1048.2±65.0 °C at 760 mmHg | |
| Molecular Formula | C32H40O19 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.0±27.8 °C | |
Use of Parishin BParishin B, a parishin derivative isolated from Gastrodia elata, may have antioxidant property[1]. |
| Name | Parishin B |
|---|---|
| Synonym | More Synonyms |
| Description | Parishin B, a parishin derivative isolated from Gastrodia elata, may have antioxidant property[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 1048.2±65.0 °C at 760 mmHg |
| Molecular Formula | C32H40O19 |
| Molecular Weight | 728.649 |
| Flash Point | 330.0±27.8 °C |
| Exact Mass | 728.216370 |
| LogP | -2.72 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | UNLDMOJTKKEMOG-IWOWLDPGSA-N |
| SMILES | O=C(O)CC(O)(CC(=O)OCc1ccc(OC2OC(CO)C(O)C(O)C2O)cc1)C(=O)OCc1ccc(OC2OC(CO)C(O)C(O)C2O)cc1 |
| [2-(Carboxymethyl)-2-hydroxy-1,4-dioxo-1,4-butanediyl]bis(oxymethylene-4,1-phenylene) bis-beta-D-glucopyranoside |
| 5-{[4-(β-D-Glucopyranosyloxy)benzyl]oxy}-3-({[4-(β-D-glucopyranosyloxy)benzyl]oxy}carbonyl)-3-hydroxy-5-oxopentanoic acid |
| 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, 1,2-bis[[4-(β-D-glucopyranosyloxy)phenyl]methyl] ester |