Benzenepropanamide, b-oxo-N-phenyl- structure
|
Common Name | Benzenepropanamide, b-oxo-N-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 959-66-0 | Molecular Weight | 239.26900 | |
| Density | 1.205g/cm3 | Boiling Point | 473.6ºC at 760mmHg | |
| Molecular Formula | C15H13NO2 | Melting Point | 106-108 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 194.5ºC | |
| Name | 2-Benzoylacetanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 473.6ºC at 760mmHg |
| Melting Point | 106-108 °C(lit.) |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.26900 |
| Flash Point | 194.5ºC |
| Exact Mass | 239.09500 |
| PSA | 46.17000 |
| LogP | 2.97110 |
| Index of Refraction | 1.624 |
| InChIKey | XRZDIHADHZSFBB-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)c1ccccc1)Nc1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| RTECS | AB4542950 |
| HS Code | 2924299090 |
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Platina-and palladalactam complexes derived from 2-benzoylacetanilide; syntheses and X-ray structure of [Pd {NPhC (O) CHC (O) Ph}(bipy)]· CH2Cl2. Henderson W, et al.
Inorganica Chim. Acta 292(2) , 260-265, (1999)
|
| 3-oxo-N,3-diphenylpropanamide |
| MFCD00003084 |
| EINECS 203-150-7 |