3-amino-4-(2-methoxyphenoxy)benzotrifluoride structure
|
Common Name | 3-amino-4-(2-methoxyphenoxy)benzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 175135-08-7 | Molecular Weight | 283.24600 | |
| Density | 1.288g/cm3 | Boiling Point | 332ºC at 760 mmHg | |
| Molecular Formula | C14H12F3NO2 | Melting Point | 28ºC | |
| MSDS | N/A | Flash Point | 154.6ºC | |
| Name | 2-(2-methoxyphenoxy)-5-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.288g/cm3 |
|---|---|
| Boiling Point | 332ºC at 760 mmHg |
| Melting Point | 28ºC |
| Molecular Formula | C14H12F3NO2 |
| Molecular Weight | 283.24600 |
| Flash Point | 154.6ºC |
| Exact Mass | 283.08200 |
| PSA | 44.48000 |
| LogP | 4.66970 |
| InChIKey | PYNDGRAUAXTKAO-UHFFFAOYSA-N |
| SMILES | COc1ccccc1Oc1ccc(C(F)(F)F)cc1N |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00052419 |