3-bromo-5-chloro-2,6-dimethoxybenzamide structure
|
Common Name | 3-bromo-5-chloro-2,6-dimethoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 175135-60-1 | Molecular Weight | 294.53000 | |
| Density | 1.598g/cm3 | Boiling Point | 306.6ºC at 760mmHg | |
| Molecular Formula | C9H9BrClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.2ºC | |
| Name | 3-bromo-5-chloro-2,6-dimethoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.598g/cm3 |
|---|---|
| Boiling Point | 306.6ºC at 760mmHg |
| Molecular Formula | C9H9BrClNO3 |
| Molecular Weight | 294.53000 |
| Flash Point | 139.2ºC |
| Exact Mass | 292.94500 |
| PSA | 61.55000 |
| LogP | 2.91890 |
| Vapour Pressure | 0.000764mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | GBVBCQIVBHAEAZ-UHFFFAOYSA-N |
| SMILES | COc1c(Cl)cc(Br)c(OC)c1C(N)=O |
| Safety Phrases | 24/25 |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| hms546e14 |