6-(4-Chlorophenyl)pyrimidine-2,4-diamine structure
|
Common Name | 6-(4-Chlorophenyl)pyrimidine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 175137-09-4 | Molecular Weight | 220.658 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 520.1±60.0 °C at 760 mmHg | |
| Molecular Formula | C10H9ClN4 | Melting Point | 158ºC | |
| MSDS | USA | Flash Point | 268.4±32.9 °C | |
| Name | 6-(4-Chlorophenyl)pyrimidine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 520.1±60.0 °C at 760 mmHg |
| Melting Point | 158ºC |
| Molecular Formula | C10H9ClN4 |
| Molecular Weight | 220.658 |
| Flash Point | 268.4±32.9 °C |
| Exact Mass | 220.051575 |
| PSA | 77.82000 |
| LogP | 1.56 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.692 |
| InChIKey | RGQMMCAWKASJGS-UHFFFAOYSA-N |
| SMILES | Nc1cc(-c2ccc(Cl)cc2)nc(N)n1 |
| Storage condition | 2-8°C |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-Pyrimidinediamine, 6-(4-chlorophenyl)- |
| 6-(4-Chlorophenyl)-2,4-pyrimidinediamine |
| 6-(4-CHLOROPHENYL)PYRIMIDINE-2,4-DIAMINE |