ethyl 2-(4-nitrophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylate structure
|
Common Name | ethyl 2-(4-nitrophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 175137-35-6 | Molecular Weight | 329.23100 | |
| Density | 1.64g/cm3 | Boiling Point | 421.8ºC at 760 mmHg | |
| Molecular Formula | C13H10F3N3O4 | Melting Point | 106-110 °C | |
| MSDS | Chinese USA | Flash Point | 208.9ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Ethyl 1-(4-nitrophenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 421.8ºC at 760 mmHg |
| Melting Point | 106-110 °C |
| Molecular Formula | C13H10F3N3O4 |
| Molecular Weight | 329.23100 |
| Flash Point | 208.9ºC |
| Exact Mass | 329.06200 |
| PSA | 89.94000 |
| LogP | 3.49920 |
| Vapour Pressure | 2.53E-07mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | QNUASRIZVSLLGS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnn(-c2ccc([N+](=O)[O-])cc2)c1C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn,Xi |
| Risk Phrases | R22:Harmful if swallowed. R36:Irritating to the eyes. |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933199090 |
|
~88%
ethyl 2-(4-nitr... CAS#:175137-35-6 |
| Literature: Obermayer, David; Glasnov, Toma N.; Kappe, C. Oliver Journal of Organic Chemistry, 2011 , vol. 76, # 16 p. 6657 - 6669 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate |
| ETHYL 2-(4-NITROPHENYL)-3-(TRIFLUOROMETHYL)PYRAZOLE-4-CARBOXYLATE |
| MFCD00173868 |