(4-nitrophenyl)hydrazinhydrochlorid structure
|
Common Name | (4-nitrophenyl)hydrazinhydrochlorid | ||
|---|---|---|---|---|
| CAS Number | 636-99-7 | Molecular Weight | 189.600 | |
| Density | N/A | Boiling Point | 344ºC at 760 mmHg | |
| Molecular Formula | C6H8ClN3O2 | Melting Point | 205-207°C | |
| MSDS | N/A | Flash Point | 161.8ºC | |
| Name | 4-Nitrophenylhydrazine Hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 344ºC at 760 mmHg |
|---|---|
| Melting Point | 205-207°C |
| Molecular Formula | C6H8ClN3O2 |
| Molecular Weight | 189.600 |
| Flash Point | 161.8ºC |
| Exact Mass | 189.030502 |
| PSA | 83.87000 |
| LogP | 2.97890 |
| InChIKey | ZWWXDCOPVYATOQ-UHFFFAOYSA-N |
| SMILES | Cl.NNc1ccc([N+](=O)[O-])cc1 |
| Hazard Codes | Xi,T |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | S26-S36/37/39-S24/25-S22 |
| RIDADR | 2811 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2928000090 |
|
~38%
(4-nitrophenyl)... CAS#:636-99-7 |
| Literature: Purohit, Meena K.; Chakka, Sai Kumar; Scovell, Iain; Neschadim, Anton; Bello, Angelica M.; Salum, Norue; Katsman, Yulia; Bareau, Madeleine C.; Branch, Donald R.; Kotra, Lakshmi P. Bioorganic and Medicinal Chemistry, 2014 , vol. 22, # 9 p. 2739 - 2752 |
|
~%
(4-nitrophenyl)... CAS#:636-99-7 |
| Literature: Tetrahedron, , vol. 67, # 52 p. 10296 - 10303 |
|
~74%
(4-nitrophenyl)... CAS#:636-99-7 |
| Literature: Kuo; Lee; Yeh Journal of the Chinese Chemical Society, 2000 , vol. 47, # 1 p. 227 - 240 |
| Precursor 2 | |
|---|---|
| DownStream 9 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| MFCD00040592 |
| (4-nitrophenyl)hydrazinhydrochlorid |
| (4-Nitrophenyl)hydrazine hydrochloride (1:1) |
| 4-Nitrophenyl Hydrazine Hydrochloride |
| EINECS 211-273-2 |
| (4-nitrophenyl)hydrazine hydrochloride |
| Hydrazine, (4-nitrophenyl)-, hydrochloride (1:1) |
| 4-Nitrophenylhydrazine hydrochloride |