2-Fluoro-6-(4-methylphenoxy)benzonitrile
Modify Date: 2025-08-25 20:39:28
2-Fluoro-6-(4-methylphenoxy)benzonitrile structure
|
Common Name | 2-Fluoro-6-(4-methylphenoxy)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 175204-08-7 | Molecular Weight | 227.23400 | |
| Density | 1.21g/cm3 | Boiling Point | 323ºC at 760mmHg | |
| Molecular Formula | C14H10FNO | Melting Point | 93-95ºC | |
| MSDS | N/A | Flash Point | 149.1ºC | |
| Name | 2-Fluoro-6-(4-methylphenoxy)benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 323ºC at 760mmHg |
| Melting Point | 93-95ºC |
| Molecular Formula | C14H10FNO |
| Molecular Weight | 227.23400 |
| Flash Point | 149.1ºC |
| Exact Mass | 227.07500 |
| PSA | 33.02000 |
| LogP | 3.79808 |
| Vapour Pressure | 0.00027mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | JLTWAYPSQIKWIL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Oc2cccc(F)c2C#N)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2926909090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: HepG2-CD81
External Id: CHEMBL4483864
|
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: Plasmodium berghei
External Id: CHEMBL4483863
|
Total 2, Current Page 1 of 1
1
| MFCD00068203 |
| 2-fluoro-6-(4-methylphenoxy)benzonitrile |