ethyl 4-acetamido-3-nitrobenzoate structure
|
Common Name | ethyl 4-acetamido-3-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 175204-17-8 | Molecular Weight | 252.22300 | |
| Density | 1.336g/cm3 | Boiling Point | 462.3ºC at 760mmHg | |
| Molecular Formula | C11H12N2O5 | Melting Point | 95-97ºC | |
| MSDS | N/A | Flash Point | 233.4ºC | |
| Name | ethyl 4-acetamido-3-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.336g/cm3 |
|---|---|
| Boiling Point | 462.3ºC at 760mmHg |
| Melting Point | 95-97ºC |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.22300 |
| Flash Point | 233.4ºC |
| Exact Mass | 252.07500 |
| PSA | 101.22000 |
| LogP | 2.32610 |
| Vapour Pressure | 1E-08mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | AQEATNDLNBFMRO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(NC(C)=O)c([N+](=O)[O-])c1 |
| Risk Phrases | 20/21/22 |
|---|---|
| Safety Phrases | 22-36/37/39 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Acetylamino-3-nitro-benzoesaeure-aethylester |
| 4-acetylamino-3-nitro-benzoic acid ethyl ester |
| ethyl 4-acetylamino-3-nitrobenzoate |
| ethyl 4-acetamido-3-nitro-benzoate |