3-(2-phenylethenylsulfonyl)propanoic acid structure
|
Common Name | 3-(2-phenylethenylsulfonyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 175205-22-8 | Molecular Weight | 240.27600 | |
| Density | 1.341g/cm3 | Boiling Point | 511.4ºC at 760mmHg | |
| Molecular Formula | C11H12O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.1ºC | |
| Name | 3-(2-phenylethenylsulfonyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.341g/cm3 |
|---|---|
| Boiling Point | 511.4ºC at 760mmHg |
| Molecular Formula | C11H12O4S |
| Molecular Weight | 240.27600 |
| Flash Point | 263.1ºC |
| Exact Mass | 240.04600 |
| PSA | 79.82000 |
| LogP | 2.62760 |
| Vapour Pressure | 2.79E-11mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | IZGAQCWABIDBNP-SOFGYWHQSA-N |
| SMILES | O=C(O)CCS(=O)(=O)C=Cc1ccccc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-(STYRYLSULFONYL)PROPANOIC ACID |
| Propanoic acid,3-[(2-phenylethenyl)sulfonyl] |
| (Z)-STYRYLSULFONYLPROPIONIC ACID |
| 3-(Styrylsulphonyl)propanoic acid |