3-(2-nitrophenyl)propanoic acid structure
|
Common Name | 3-(2-nitrophenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2001-32-3 | Molecular Weight | 195.17200 | |
| Density | 1.343g/cm3 | Boiling Point | 353.5ºC at 760mmHg | |
| Molecular Formula | C9H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.4ºC | |
| Name | 3-(2-nitrophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.343g/cm3 |
|---|---|
| Boiling Point | 353.5ºC at 760mmHg |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17200 |
| Flash Point | 156.4ºC |
| Exact Mass | 195.05300 |
| PSA | 83.12000 |
| LogP | 2.13520 |
| Vapour Pressure | 1.31E-05mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | OARKUZWAGHQLSL-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1ccccc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
| Precursor 9 | |
|---|---|
| DownStream 7 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzenepropanoic acid,2-nitro |
| 2-Nitro-hydrozimtsaeure |