3-bromo-5-chloro-4-iodobenzotrifluoride
3-bromo-5-chloro-4-iodobenzotrifluoride structure
|
Common Name | 3-bromo-5-chloro-4-iodobenzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 175205-55-7 | Molecular Weight | 385.34700 | |
| Density | 2.225g/cm3 | Boiling Point | 259.2ºC at 760mmHg | |
| Molecular Formula | C7H2BrClF3I | Melting Point | 29ºC | |
| MSDS | N/A | Flash Point | 110.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.225g/cm3 |
|---|---|
| Boiling Point | 259.2ºC at 760mmHg |
| Melting Point | 29ºC |
| Molecular Formula | C7H2BrClF3I |
| Molecular Weight | 385.34700 |
| Flash Point | 110.6ºC |
| Exact Mass | 383.80300 |
| LogP | 4.72590 |
| InChIKey | RDWKEGGZLPOJAE-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(Cl)c(I)c(Br)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-bromo-5-chlor... CAS#:175205-55-7 |
| Literature: US2012/302610 A1, ; Page/Page column 55 ; US 20120302610 A1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Bromo-5-chloro-4-iodobenzotrifluoride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene? |
| A: SMILES notation of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene is FC(F)(F)c1cc(Cl)c(I)c(Br)c1. |
| Q: What is the CAS number of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene? |
| A: CAS number of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene is 175205-55-7. |
| Q: What is the English name of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene? |
| A: The English name of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene is 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene. |
| Q: What is the molecular weight of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene? |
| A: Molecular weight of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene is 385.34700. |
| Q: What is the melting point of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene? |
| A: Melting point of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene is 29ºC. |
| Q: What is the InChIKey of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene? |
| A: InChIKey of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene is RDWKEGGZLPOJAE-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene? |
| A: Molecular formula of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene is C7H2BrClF3I. |
| Q: What is the boiling point of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene? |
| A: Boiling point of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene is 259.2ºC at 760mmHg. |
| Q: What English synonyms does 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene have? |
| A: English synonyms of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene: 3-Bromo-5-chloro-4-iodobenzotrifluoride. |
| Q: What are the upstream materials of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene? |
| A: Related upstream materials(CAS) of 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene: 109919-26-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |