4,6-dichloro-2H-chromene-3-carbaldehyde structure
|
Common Name | 4,6-dichloro-2H-chromene-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 175205-58-0 | Molecular Weight | 229.05900 | |
| Density | 1.46g/cm3 | Boiling Point | 369.3ºC at 760mmHg | |
| Molecular Formula | C10H6Cl2O2 | Melting Point | 124-128ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 166.5ºC | |
| Name | 4,6-dichloro-2H-chromene-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 369.3ºC at 760mmHg |
| Melting Point | 124-128ºC(lit.) |
| Molecular Formula | C10H6Cl2O2 |
| Molecular Weight | 229.05900 |
| Flash Point | 166.5ºC |
| Exact Mass | 227.97400 |
| PSA | 26.30000 |
| LogP | 2.88120 |
| Vapour Pressure | 1.2E-05mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | XEGONRKPLYJCFN-UHFFFAOYSA-N |
| SMILES | O=CC1=C(Cl)c2cc(Cl)ccc2OC1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932999099 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00084992 |
| 4,6-dichloro-2H-3-chromene carbaldehyde |