4,6-dichloro-2H-chromene-3-carbaldehyde
4,6-dichloro-2H-chromene-3-carbaldehyde structure
|
Common Name | 4,6-dichloro-2H-chromene-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 175205-58-0 | Molecular Weight | 229.05900 | |
| Density | 1.46g/cm3 | Boiling Point | 369.3ºC at 760mmHg | |
| Molecular Formula | C10H6Cl2O2 | Melting Point | 124-128ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 166.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,6-dichloro-2H-chromene-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 369.3ºC at 760mmHg |
| Melting Point | 124-128ºC(lit.) |
| Molecular Formula | C10H6Cl2O2 |
| Molecular Weight | 229.05900 |
| Flash Point | 166.5ºC |
| Exact Mass | 227.97400 |
| PSA | 26.30000 |
| LogP | 2.88120 |
| Vapour Pressure | 1.2E-05mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | XEGONRKPLYJCFN-UHFFFAOYSA-N |
| SMILES | O=CC1=C(Cl)c2cc(Cl)ccc2OC1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932999099 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:37674-72-9
CAS#:68-12-2This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD00084992 |
| 4,6-dichloro-2H-3-chromene carbaldehyde |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 4,6-dichloro-2H-chromene-3-carbaldehyde? |
| A: Boiling point of 4,6-dichloro-2H-chromene-3-carbaldehyde is 369.3ºC at 760mmHg. |
| Q: What is the English name of 4,6-dichloro-2H-chromene-3-carbaldehyde? |
| A: The English name of 4,6-dichloro-2H-chromene-3-carbaldehyde is 4,6-dichloro-2H-chromene-3-carbaldehyde. |
| Q: What is the molecular weight of 4,6-dichloro-2H-chromene-3-carbaldehyde? |
| A: Molecular weight of 4,6-dichloro-2H-chromene-3-carbaldehyde is 229.05900. |
| Q: What is the safety information for 4,6-dichloro-2H-chromene-3-carbaldehyde? |
| A: Safety information for 4,6-dichloro-2H-chromene-3-carbaldehyde: S22-S24/25. |
| Q: What is the SMILES notation of 4,6-dichloro-2H-chromene-3-carbaldehyde? |
| A: SMILES notation of 4,6-dichloro-2H-chromene-3-carbaldehyde is O=CC1=C(Cl)c2cc(Cl)ccc2OC1. |
| Q: What is the InChIKey of 4,6-dichloro-2H-chromene-3-carbaldehyde? |
| A: InChIKey of 4,6-dichloro-2H-chromene-3-carbaldehyde is XEGONRKPLYJCFN-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 4,6-dichloro-2H-chromene-3-carbaldehyde? |
| A: Related upstream materials(CAS) of 4,6-dichloro-2H-chromene-3-carbaldehyde: 37674-72-9;68-12-2. |
| Q: What is the LogP of 4,6-dichloro-2H-chromene-3-carbaldehyde? |
| A: LogP of 4,6-dichloro-2H-chromene-3-carbaldehyde is 2.88120. |
| Q: What is the CAS number of 4,6-dichloro-2H-chromene-3-carbaldehyde? |
| A: CAS number of 4,6-dichloro-2H-chromene-3-carbaldehyde is 175205-58-0. |
| Q: What is the polar surface area (PSA) of 4,6-dichloro-2H-chromene-3-carbaldehyde? |
| A: Polar surface area (PSA) of 4,6-dichloro-2H-chromene-3-carbaldehyde is 26.30000. |