lucidin ethyl ether structure
|
Common Name | lucidin ethyl ether | ||
|---|---|---|---|---|
| CAS Number | 17526-17-9 | Molecular Weight | 298.29000 | |
| Density | 1.409g/cm3 | Boiling Point | 540.6ºC at 760 mmHg | |
| Molecular Formula | C17H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.7ºC | |
Use of lucidin ethyl etherLucidin ω-ethyl ether (compound 17) is an anthraquinone metabolite isolated from the root part of Prismatomeris filamentosa with some antibacterial activity against Gram-positive and Gram-negative bacteria[1]. |
| Name | 2-(ethoxymethyl)-1,3-dihydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Lucidin ω-ethyl ether (compound 17) is an anthraquinone metabolite isolated from the root part of Prismatomeris filamentosa with some antibacterial activity against Gram-positive and Gram-negative bacteria[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.409g/cm3 |
|---|---|
| Boiling Point | 540.6ºC at 760 mmHg |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29000 |
| Flash Point | 203.7ºC |
| Exact Mass | 298.08400 |
| PSA | 83.83000 |
| LogP | 2.40970 |
| Vapour Pressure | 2.67E-12mmHg at 25°C |
| Index of Refraction | 1.662 |
| InChIKey | VRARPPQMEQUQET-UHFFFAOYSA-N |
| SMILES | CCOCc1c(O)cc2c(c1O)C(=O)c1ccccc1C2=O |
| HS Code | 2914690090 |
|---|
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-Ethoxymethyl-1,3-dihydroxyanthraquinone |
| 1,3-Dihydroxy-2-ethoxymethylanthraquinone |
| Ibericin |
| ANTHRAQUINONE,1,3-DIHYDROXY-2-ETHOXYMETHYL |
| Lucidin ethyl ether |
| 2-(Ethoxymethyl)-1,3-dihydroxy-9,10-anthracenedione |
| Anthraquinone,2-(ethoxymethyl)-1,3-dihydroxy-(7CI,8CI) |
| 1,3-dihydroxy-2-ethoxymethyl-9,10-anthraquinone |