Benzoin ethyl ether structure
|
Common Name | Benzoin ethyl ether | ||
|---|---|---|---|---|
| CAS Number | 574-09-4 | Molecular Weight | 240.297 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 357.8±30.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | 59-61 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 152.3±18.1 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | Benzoin Ethyl Ether |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 357.8±30.0 °C at 760 mmHg |
| Melting Point | 59-61 °C(lit.) |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.297 |
| Flash Point | 152.3±18.1 °C |
| Exact Mass | 240.115036 |
| PSA | 26.30000 |
| LogP | 3.90 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | KMNCBSZOIQAUFX-UHFFFAOYSA-N |
| SMILES | CCOC(C(=O)c1ccccc1)c1ccccc1 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H400 |
| Precautionary Statements | P273-P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi,N |
| Risk Phrases | R43 |
| Safety Phrases | S36/37-S60-S61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| HS Code | 2942000000 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Identification and functional distribution of intracellular ca channels in mouse lacrimal gland acinar cells.
Open Ophthalmol J 1 , 8-16, (2009) We have determined the presence and cellular distribution of intracellular calcium channels, inositol 1, 4, 5-trisphosphate receptors (IP3Rs) and ryanodine receptors (RyRs) in adult and postnatal (P10... |
|
|
A novel immunofluorescent computed tomography (ICT) method to localise and quantify multiple antigens in large tissue volumes at high resolution.
PLoS ONE 7 , e53245, (2013) Current immunofluorescence protocols are limited as they do not provide reliable antibody staining within large tissue volumes (mm(3)) and cannot localise and quantify multiple antigens or cell popula... |
| Acetophenone, 2-ethoxy-2-phenyl- |
| 2-ethoxy-1,2-diphenylethan-1-one |
| ETHYL BENZOIN ETHER |
| EINECS 209-366-8 |
| α-Ethoxy-α-phenylacetophenone |
| Ethanone, 2-ethoxy-1,2-diphenyl- |
| Benzoin Ethyl Ether |
| MFCD00009242 |
| 2-ETHOXY-2-PHENYLACETOPHENONE |
| 2-Ethoxy-1,2-diphenylethanone |
| 2-Ethoxybenzoin |