2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one
2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one structure
|
Common Name | 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 175354-56-0 | Molecular Weight | 194.111 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 153.1±50.0°C | |
| Molecular Formula | C6H5F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 153.1±50.0°C |
| Molecular Formula | C6H5F3N2O2 |
| Molecular Weight | 194.111 |
| Exact Mass | 194.030319 |
| PSA | 55.24000 |
| LogP | 1.46 |
| Index of Refraction | 1.478 |
| InChIKey | ILOOCRYHYUMTKL-UHFFFAOYSA-N |
| SMILES | COc1nc(C(F)(F)F)cc(=O)[nH]1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:672-45-7
CAS#:932701-90-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone |
| 2-methoxy-6-(trifluoromethyl)-1H-pyrimidin-4-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one have? |
| A: English synonyms of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one: 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone, 2-methoxy-6-(trifluoromethyl)-1H-pyrimidin-4-one. |
| Q: What is the polar surface area (PSA) of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one? |
| A: Polar surface area (PSA) of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one is 55.24000. |
| Q: What is the molecular formula of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one? |
| A: Molecular formula of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one is C6H5F3N2O2. |
| Q: What is the English name of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one? |
| A: The English name of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one is 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one. |
| Q: What is the SMILES notation of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one? |
| A: SMILES notation of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one is COc1nc(C(F)(F)F)cc(=O)[nH]1. |
| Q: What is the molecular weight of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one? |
| A: Molecular weight of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one is 194.111. |
| Q: What are the downstream products of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one? |
| A: Related downstream products(CAS) of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one: 672-45-7;932701-90-1. |
| Q: What is the CAS number of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one? |
| A: CAS number of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one is 175354-56-0. |
| Q: What is the LogP of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one? |
| A: LogP of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one is 1.46. |
| Q: What is the boiling point of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one? |
| A: Boiling point of 2-Methoxy-6-(trifluoromethyl)pyrimidin-4(3H)-one is 153.1±50.0°C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |