2-Propen-1-one,1-(2,4-dihydroxyphenyl)-3-phenyl
2-Propen-1-one,1-(2,4-dihydroxyphenyl)-3-phenyl structure
|
Common Name | 2-Propen-1-one,1-(2,4-dihydroxyphenyl)-3-phenyl | ||
|---|---|---|---|---|
| CAS Number | 1776-30-3 | Molecular Weight | 240.25400 | |
| Density | 1.286g/cm3 | Boiling Point | 453.5ºC at 760 mmHg | |
| Molecular Formula | C15H12O3 | Melting Point | 170ºC | |
| MSDS | N/A | Flash Point | 242.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2',4'-dihydroxychalcone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 453.5ºC at 760 mmHg |
| Melting Point | 170ºC |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.25400 |
| Flash Point | 242.2ºC |
| Exact Mass | 240.07900 |
| PSA | 57.53000 |
| LogP | 2.99390 |
| Vapour Pressure | 7.64E-09mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | JUMSUVHHUVPSOY-UHFFFAOYSA-N |
| SMILES | O=C(C=Cc1ccccc1)c1ccc(O)cc1O |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 8 | |
CAS#:109386-28-9
CAS#:93-58-3
CAS#:89-86-1
CAS#:65-85-0
CAS#:6515-36-2
CAS#:6665-86-7
CAS#:53596-71-7
CAS#:492-00-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2',4'-dihydroxylchalcone |
| 2',4'-dihydroxy-trans-chalcone |
| 2',4'-Dihydroxy-trans-chalkon |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2',4'-dihydroxychalcone? |
| A: SMILES notation of 2',4'-dihydroxychalcone is O=C(C=Cc1ccccc1)c1ccc(O)cc1O. |
| Q: What is the melting point of 2',4'-dihydroxychalcone? |
| A: Melting point of 2',4'-dihydroxychalcone is 170ºC. |
| Q: What is the CAS number of 2',4'-dihydroxychalcone? |
| A: CAS number of 2',4'-dihydroxychalcone is 1776-30-3. |
| Q: What English synonyms does 2',4'-dihydroxychalcone have? |
| A: English synonyms of 2',4'-dihydroxychalcone: 2',4'-dihydroxylchalcone, 2',4'-dihydroxy-trans-chalcone, 2',4'-Dihydroxy-trans-chalkon. |
| Q: What is the boiling point of 2',4'-dihydroxychalcone? |
| A: Boiling point of 2',4'-dihydroxychalcone is 453.5ºC at 760 mmHg. |
| Q: What is the molecular weight of 2',4'-dihydroxychalcone? |
| A: Molecular weight of 2',4'-dihydroxychalcone is 240.25400. |
| Q: What is the English name of 2',4'-dihydroxychalcone? |
| A: The English name of 2',4'-dihydroxychalcone is 2',4'-dihydroxychalcone. |
| Q: What is the InChIKey of 2',4'-dihydroxychalcone? |
| A: InChIKey of 2',4'-dihydroxychalcone is JUMSUVHHUVPSOY-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2',4'-dihydroxychalcone? |
| A: Molecular formula of 2',4'-dihydroxychalcone is C15H12O3. |
| Q: What is the polar surface area (PSA) of 2',4'-dihydroxychalcone? |
| A: Polar surface area (PSA) of 2',4'-dihydroxychalcone is 57.53000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| naturewill |