5-bromo-4-chloro-3-indolyl beta-d-cellobioside structure
|
Common Name | 5-bromo-4-chloro-3-indolyl beta-d-cellobioside | ||
|---|---|---|---|---|
| CAS Number | 177966-52-8 | Molecular Weight | 570.77000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H25BrClNO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5-bromo-4-chloro-3-indolyl beta-d-cellobioside5-Bromo-4-chloro-3-indolyl β-D-cellobioside is a chromogenic compound used to detect cellobiohydrolases[1]. |
| Name | 2-[6-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| Synonym | More Synonyms |
| Description | 5-Bromo-4-chloro-3-indolyl β-D-cellobioside is a chromogenic compound used to detect cellobiohydrolases[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H25BrClNO11 |
|---|---|
| Molecular Weight | 570.77000 |
| Exact Mass | 569.03000 |
| PSA | 194.32000 |
| InChIKey | TXCDHJGGJYHESA-OIHNOWRXSA-N |
| SMILES | OCC1OC(OC2C(CO)OC(Oc3c[nH]c4ccc(Br)c(Cl)c34)C(O)C2O)C(O)C(O)C1O |
| Storage condition | −20°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 3 |
| MFCD00798387 |