N,N-Bis(trimethylsilyl)-N'-phenylethylenediamine structure
|
Common Name | N,N-Bis(trimethylsilyl)-N'-phenylethylenediamine | ||
|---|---|---|---|---|
| CAS Number | 17814-46-9 | Molecular Weight | 280.55700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H28N2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-phenyl-N',N'-bis(trimethylsilyl)ethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H28N2Si2 |
|---|---|
| Molecular Weight | 280.55700 |
| Exact Mass | 280.17900 |
| PSA | 15.27000 |
| LogP | 4.14330 |
| InChIKey | NOQZOZOGULWLKP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N(CCNc1ccccc1)[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Ethylenediamine,N'-phenyl-N,N-bis(trimethylsilyl) |
| N,N-Bis(trimethylsilyl)-N'-phenylethylenediamine |