ARRY 520 trifluoroacetate structure
|
Common Name | ARRY 520 trifluoroacetate | ||
|---|---|---|---|---|
| CAS Number | 1781834-99-8 | Molecular Weight | 534.499 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H23F5N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ARRY 520 trifluoroacetateFilanesib, also known as ARRY-520, is a synthetic, small molecule targeting the kinesin spindle protein (KSP) with potential antineoplastic activity. KSP inhibitor ARRY-520 specifically inhibits KSP (kinesin-5 or Eg5), resulting in activation of the spindle assembly checkpoint, induction of cell cycle arrest during the mitotic phase, and consequently cell death in tumor cells that are actively dividing. Because KSP is not involved in postmitotic processes, such as neuronal transport, this agent does not cause the peripheral neuropathy that is often associated with tubulin-targeting agents. |
| Name | ARRY-520 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H23F5N4O4S |
|---|---|
| Molecular Weight | 534.499 |
| Exact Mass | 534.135986 |
| InChIKey | CIJUJPVFECBUKG-BDQAORGHSA-N |
| SMILES | CON(C)C(=O)N1N=C(c2cc(F)ccc2F)SC1(CCCN)c1ccccc1.O=C(O)C(F)(F)F |
| Acetic acid, 2,2,2-trifluoro-, compd. with (2S)-2-(3-aminopropyl)-5-(2,5-difluorophenyl)-N-methoxy-N-methyl-2-phenyl-1,3,4-thiadiazole-3(2H)-carboxamide (1:1) |
| (2S)-2-(3-Aminopropyl)-5-(2,5-difluorophenyl)-N-methoxy-N-methyl-2-phenyl-1,3,4-thiadiazole-3(2H)-carboxamide trifluoroacetate (1:1) |
| ARRY-520 |