(E)-2-OXO-4-PHENYLBUT-3-ENENITRILE structure
|
Common Name | (E)-2-OXO-4-PHENYLBUT-3-ENENITRILE | ||
|---|---|---|---|---|
| CAS Number | 178445-80-2 | Molecular Weight | 284.30700 | |
| Density | 1.203g/cm3 | Boiling Point | 488.2ºC at 760mmHg | |
| Molecular Formula | C17H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.7ºC | |
| Name | (e)-3-(3,4-dimethoxyphenyl)-1-(3-hydroxyphenyl)-1-propenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 488.2ºC at 760mmHg |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.30700 |
| Flash Point | 180.7ºC |
| Exact Mass | 284.10500 |
| PSA | 55.76000 |
| LogP | 3.30550 |
| Vapour Pressure | 3.74E-10mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | INUGQAHOPUVTAQ-SOFGYWHQSA-N |
| SMILES | COc1ccc(C=CC(=O)c2cccc(O)c2)cc1OC |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2914509090 |
|
~88%
(E)-2-OXO-4-PHE... CAS#:178445-80-2 |
| Literature: Keenan, Terence; Yaeger, David R.; Courage, Nancy L.; Rollins, Carl T.; Pavone, Mary Ellen; Rivera, Victor M.; Yang, Wu; Guo, Tao; Amara, Jane F.; Clackson, Tim; Gilman, Michael; Holt, Dennis A. Bioorganic and Medicinal Chemistry, 1998 , vol. 6, # 8 p. 1309 - 1335 |
|
~%
(E)-2-OXO-4-PHE... CAS#:178445-80-2 |
| Literature: Ariad Pharmaceuticals, Inc. Patent: US6150527 A1, 2000 ; |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (E)-3-(3,4-Dimethoxyphenyl)-1-(3-hydroxyphenyl)prop-2-en-1-one |
| 3'-hydroxy-3,4-dimethoxychalcone |
| 3,4-Dimethoxy-3'-hydroxy chalcone |
| (E)-3-(3,4-dimethoxyphenyl)-1-(3-hydroxyphenyl)-2-propen-1-one |