3-(3,4-DIMETHOXYPHENYL)-1-(3-HYDROXYPHENYL)-1-PROPANONE structure
|
Common Name | 3-(3,4-DIMETHOXYPHENYL)-1-(3-HYDROXYPHENYL)-1-PROPANONE | ||
|---|---|---|---|---|
| CAS Number | 178445-83-5 | Molecular Weight | 286.32200 | |
| Density | 1.17g/cm3 | Boiling Point | 479.1ºC at 760mmHg | |
| Molecular Formula | C17H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.8ºC | |
| Name | 3-(3,4-dimethoxyphenyl)-1-(3-hydroxyphenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 479.1ºC at 760mmHg |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.32200 |
| Flash Point | 175.8ºC |
| Exact Mass | 286.12100 |
| PSA | 55.76000 |
| LogP | 3.22490 |
| Vapour Pressure | 8.41E-10mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | FHRRNHCFBUDADJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCC(=O)c2cccc(O)c2)cc1OC |
| Hazard Codes | F: Flammable; |
|---|---|
| HS Code | 2914509090 |
|
~87%
3-(3,4-DIMETHOX... CAS#:178445-83-5 |
| Literature: ARIAD PHARMACEUTICALS, INCORPORATED; LI, Feng; WANG, Yihan Patent: WO2012/103279 A2, 2012 ; Location in patent: Page/Page column 7-8 ; |
|
~%
3-(3,4-DIMETHOX... CAS#:178445-83-5 |
| Literature: ARIAD PHARMACEUTICALS, INCORPORATED; LI, Feng; WANG, Yihan Patent: WO2012/103279 A2, 2012 ; |
|
~%
3-(3,4-DIMETHOX... CAS#:178445-83-5 |
| Literature: ARIAD PHARMACEUTICALS, INCORPORATED; LI, Feng; WANG, Yihan Patent: WO2012/103279 A2, 2012 ; |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD06245367 |