2-Fluoro-5-(trifluoromethyl)phenylacetic acid
Modify Date: 2025-08-29 19:31:06
2-Fluoro-5-(trifluoromethyl)phenylacetic acid structure
|
Common Name | 2-Fluoro-5-(trifluoromethyl)phenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 178748-05-5 | Molecular Weight | 222.136 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 246.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H6F4O2 | Melting Point | 113-116 °C(lit.) | |
| MSDS | N/A | Flash Point | 102.6±25.9 °C | |
| Name | 2-fluoro-3-(trifluoromethyl)phenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 246.0±35.0 °C at 760 mmHg |
| Melting Point | 113-116 °C(lit.) |
| Molecular Formula | C9H6F4O2 |
| Molecular Weight | 222.136 |
| Flash Point | 102.6±25.9 °C |
| Exact Mass | 222.030396 |
| PSA | 37.30000 |
| LogP | 2.24 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.460 |
| InChIKey | XOUMAABXMXACFQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(C(F)(F)F)c1F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzeneacetic acid, 2-fluoro-5-(trifluoromethyl)- |
| MFCD00061185 |
| [2-Fluoro-5-(trifluoromethyl)phenyl]acetic acid |
| 2-Fluoro-5-(trifluoromethyl)phenylacetic acid |
| 2-fluoro-3-trifluoroethylphenylacetic acid |
| QV1R BF EXFFF |
| 2-Fluoro-5-(trifluoromethyl)benzeneacetic acid |