2-chloro-5-(trifluoromethyl)phenylacetic acid structure
|
Common Name | 2-chloro-5-(trifluoromethyl)phenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 22893-39-6 | Molecular Weight | 238.59100 | |
| Density | 1.469g/cm3 | Boiling Point | 282.8ºC at 760mmHg | |
| Molecular Formula | C9H6ClF3O2 | Melting Point | 112-114°C | |
| MSDS | N/A | Flash Point | 124.9ºC | |
Use of 2-chloro-5-(trifluoromethyl)phenylacetic acid |
| Name | 2-[2-chloro-5-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.469g/cm3 |
|---|---|
| Boiling Point | 282.8ºC at 760mmHg |
| Melting Point | 112-114°C |
| Molecular Formula | C9H6ClF3O2 |
| Molecular Weight | 238.59100 |
| Flash Point | 124.9ºC |
| Exact Mass | 238.00100 |
| PSA | 37.30000 |
| LogP | 2.98590 |
| Vapour Pressure | 0.00155mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | PDKWZFJSOMUXLE-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cc(C(F)(F)F)ccc1Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2916399090 |
|
~%
2-chloro-5-(tri... CAS#:22893-39-6 |
| Literature: WO2005/80340 A1, ; Page/Page column 45 ; |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD01631471 |
| 2-Chloro-5-(trifluoromethyl)phenylacetic acid |
| 2-(2-Chloro-5-(trifluoromethyl)phenyl)acetic acid |