l-4-pyridylalanine structure
|
Common Name | l-4-pyridylalanine | ||
|---|---|---|---|---|
| CAS Number | 178933-04-5 | Molecular Weight | 166.17700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10N2O2 | Melting Point | 206 °C(dec.) | |
| MSDS | N/A | Flash Point | N/A | |
Use of l-4-pyridylalanine(S)-2-Amino-3-(pyridin-4-yl)propanoic acid dihydrochloride is an alanine derivative[1]. |
| Name | (2S)-2-amino-3-pyridin-4-ylpropanoic acid,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-2-Amino-3-(pyridin-4-yl)propanoic acid dihydrochloride is an alanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Melting Point | 206 °C(dec.) |
|---|---|
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.17700 |
| Exact Mass | 166.07400 |
| PSA | 76.21000 |
| LogP | 0.73630 |
| InChIKey | NAMMTAFKUFJMSD-KLXURFKVSA-N |
| SMILES | Cl.Cl.NC(Cc1ccncc1)C(=O)O |
| Hazard Codes | Xi |
|---|---|
| WGK Germany | 3 |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(4-Pyridyl)-L-alanine Dihydrochloride |