2,5-dimethoxy-3-nitrobenzoic acid structure
|
Common Name | 2,5-dimethoxy-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 17894-26-7 | Molecular Weight | 227.17100 | |
| Density | N/A | Boiling Point | 427.5ºC at 760mmHg | |
| Molecular Formula | C9H9NO6 | Melting Point | 183-187 °C(lit.) | |
| MSDS | USA | Flash Point | 212.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,5-dimethoxy-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 427.5ºC at 760mmHg |
|---|---|
| Melting Point | 183-187 °C(lit.) |
| Molecular Formula | C9H9NO6 |
| Molecular Weight | 227.17100 |
| Flash Point | 212.3ºC |
| Exact Mass | 227.04300 |
| PSA | 101.58000 |
| LogP | 1.83340 |
| Vapour Pressure | 4.55E-08mmHg at 25°C |
| InChIKey | QCJROOYLFVYZEP-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)c(OC)c([N+](=O)[O-])c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918990090 |
|
~54%
2,5-dimethoxy-3... CAS#:17894-26-7 |
| Literature: Yan, Yan; Qin, Bo; Ren, Changliang; Yip, Yeow Kwan; Ye, Ruijuan; Zeng, Huaqiang; Chen, Xiuying; Su, Haibin; Zhang, Dawei Journal of the American Chemical Society, 2010 , vol. 132, # 16 p. 5869 - 5879 |
|
~0%
2,5-dimethoxy-3... CAS#:17894-26-7 |
| Literature: Tapia, Ricardo A.; Centella, Cesar R.; Valderrama, Jaime A. Synthetic Communications, 1999 , vol. 29, # 12 p. 2163 - 2168 |
|
~%
2,5-dimethoxy-3... CAS#:17894-26-7 |
| Literature: Journal of the Chemical Society, , vol. 127, p. 2003 |
|
~%
2,5-dimethoxy-3... CAS#:17894-26-7 |
| Literature: Rikagaku Kenkyusho Iho, , vol. 11, p. 304,310 Bl. Inst. phys. chem. Res. Abstr. TokyoChem.Abstr., , vol. 5, p. 25 Bl. Inst. phys. chem. Res. Abstr. TokyoChem.Abstr., , p. 5300 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,4-DIHYDROXYBENZOIC ACID ETHANOLAMIDE |
| MFCD00017022 |
| Dimethylaether-3-nitro-gentisinsaeure |
| 3-Nitro-2,5-dimethoxy-bezoic acid |
| 2,5-Dimethoxy-3-nitrobenzoic Acid |
| 2,5-Dimethoxy-3-nitro-benzoesaeure |
| 2,5-Dimethoxy-3-nitro benzoic acid |