3-[(tert-Butoxycarbonyl)amino]isonicotinic acid structure
|
Common Name | 3-[(tert-Butoxycarbonyl)amino]isonicotinic acid | ||
|---|---|---|---|---|
| CAS Number | 179024-65-8 | Molecular Weight | 238.240 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 399.4±27.0 °C at 760 mmHg | |
| Molecular Formula | C11H14N2O4 | Melting Point | 280ºC(dec) | |
| MSDS | N/A | Flash Point | 195.3±23.7 °C | |
| Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 399.4±27.0 °C at 760 mmHg |
| Melting Point | 280ºC(dec) |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.240 |
| Flash Point | 195.3±23.7 °C |
| Exact Mass | 238.095352 |
| PSA | 88.52000 |
| LogP | 2.97 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | ZZXUPXUHQHTUNH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cnccc1C(=O)O |
| Storage condition | 2-8°C |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-t-butyloxycarbonylaminopyridine-4-carboxylic acid |
| 3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)isonicotinic acid |
| 3-tert-butoxycarbonylamino-isonicotinic acid |
| 4-Pyridinecarboxylic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| 3-(tert-Butoxycarbonyl)isonicotinic acid |
| MFCD03427723 |
| 3-Boc-amino-isonicotinic acid |
| 3-[(tert-Butoxycarbonyl)amino]isonicotinic acid |
| tertbutoxycarbonylaminoisonicotinicacid |