CPCCOEt structure
|
Common Name | CPCCOEt | ||
|---|---|---|---|---|
| CAS Number | 179067-99-3 | Molecular Weight | 247.24700 | |
| Density | 1.42g/cm3 | Boiling Point | 397.8ºC at 760mmHg | |
| Molecular Formula | C13H13NO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 194.4ºC | |
Use of CPCCOEtCPCCOEt is a low affinity, selective, non-competitive and reversible antagonist of metabotropic glutamate receptor 1b (mGluR1b)[1][2]. |
| Name | CPCCOEt,7-(Hydroxyimino)cyclopropa[b]chromen-1a-carboxylateethylester |
|---|---|
| Synonym | More Synonyms |
| Description | CPCCOEt is a low affinity, selective, non-competitive and reversible antagonist of metabotropic glutamate receptor 1b (mGluR1b)[1][2]. |
|---|---|
| Related Catalog | |
| Target |
mGluR1b |
| References |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 397.8ºC at 760mmHg |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.24700 |
| Flash Point | 194.4ºC |
| Exact Mass | 247.08400 |
| PSA | 68.12000 |
| LogP | 1.57910 |
| Vapour Pressure | 4.82E-07mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | FXCTZFMSAHZQTR-KAMYIIQDSA-N |
| SMILES | CCOC(=O)C12CC1C(=NO)c1ccccc1O2 |
| Safety Phrases | 22-24/25 |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| CPCCOET |
| Astemizole |