tert-Butoxy(chloro)diphenylsilane structure
|
Common Name | tert-Butoxy(chloro)diphenylsilane | ||
|---|---|---|---|---|
| CAS Number | 17922-24-6 | Molecular Weight | 290.860 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 331.0±15.0 °C at 760 mmHg | |
| Molecular Formula | C16H19ClOSi | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 128.2±12.5 °C | |
| Symbol |
GHS02, GHS05 |
Signal Word | Danger | |
| Name | chloro-[(2-methylpropan-2-yl)oxy]-diphenylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 331.0±15.0 °C at 760 mmHg |
| Molecular Formula | C16H19ClOSi |
| Molecular Weight | 290.860 |
| Flash Point | 128.2±12.5 °C |
| Exact Mass | 290.089355 |
| PSA | 9.23000 |
| LogP | 7.36 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | MSZDOMFSWXWKTK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)O[Si](Cl)(c1ccccc1)c1ccccc1 |
| Storage condition | −20°C |
| Symbol |
GHS02, GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H226-H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 2986 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2931900090 |
|
~86%
tert-Butoxy(chl... CAS#:17922-24-6 |
| Literature: Kojima, Satoshi; Fukuzaki, Tomohide; Yamakawa, Atsushi; Murai, Yutaka Organic Letters, 2004 , vol. 6, # 22 p. 3917 - 3920 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
Gillard, J.W., et al.
J. Org. Chem. 53 , 2602, (1988)
|
|
|
M. Grotli, B.S. Sproat
J. Chem. Soc. Chem. Commun. , 495, (1995)
|
| Chloro[(2-methyl-2-propanyl)oxy]diphenylsilane |
| diphenyl-t-butoxysilyl chloride |
| tert-Butoxydiphenylsilyl Chloride |
| MFCD00077672 |
| tert-Butoxy(chloro)diphenylsilane |
| tert-butyloxydiphenylsilyl chloride |
| t-butoxydiphenylsilyl chloride |
| tert-Butoxychlorodiphenylsilane |
| tert-Butoxy-diphenylchlorosilane |
| Benzene, 1,1'-[chloro(1,1-dimethylethoxy)silylene]bis- |
| tert-Butoxydiphenylchlorosilane |