3-Phenoxybenzoic acid-13C6 structure
|
Common Name | 3-Phenoxybenzoic acid-13C6 | ||
|---|---|---|---|---|
| CAS Number | 1793055-05-6 | Molecular Weight | 220.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C713C6H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3-Phenoxybenzoic acid-13C63-Phenoxybenzoic acid-13C6 is the 13C6 labeled 3-Phenoxybenzoic acid. 3-Phenoxybenzoic acid is an endogenous metabolite. |
| Name | 3-Phenoxybenzoic acid-13C6 |
|---|
| Description | 3-Phenoxybenzoic acid-13C6 is the 13C6 labeled 3-Phenoxybenzoic acid. 3-Phenoxybenzoic acid is an endogenous metabolite. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C713C6H10O3 |
|---|---|
| Molecular Weight | 220.17 |
| InChIKey | NXTDJHZGHOFSQG-UJVDBDNBSA-N |
| SMILES | O=C(O)c1cccc(Oc2ccccc2)c1 |